C31H52O10 — CID 70872812
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(5,9,13-trimethyltetradec-4-enoxy)oxan-2-yl]methyl acetate (PubChem CID 70872812) has the molecular formula C31H52O10 and a molecular weight of 584.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(5,9,13-trimethyltetradec-4-enoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(5,9,13-trimethyltetradec-4-enoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70872812 |
| Molecular Formula | C31H52O10 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(5,9,13-trimethyltetradec-4-enoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OCCCC=C(C)CCCC(C)CCCC(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H52O10/c1-20(2)13-11-15-22(4)17-12-16-21(3)14-9-10-18-36-31-30(40-26(8)35)29(39-25(7)34)28(38-24(6)33)27(41-31)19-37-23(5)32/h14,20,22,27-31H,9-13,15-19H2,1-8H3/t22?,27-,28-,29+,30-,31?/m1/s1 |
| InChIKey | NDUPCCMXGSIYKP-UGVBBXPISA-N |
| XLogP | 5.45 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|