About tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate
tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 70872876) has the molecular formula C17H26F2N2O3
and a molecular weight of 344.40 g/mol. Its IUPAC name is tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| PubChem CID | 70872876 |
| Molecular Formula | C17H26F2N2O3 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC#CCN1CC(F)(F)OC2(CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C17H26F2N2O3/c1-5-6-9-20-12-16(24-17(18,19)13-20)7-10-21(11-8-16)14(22)23-15(2,3)4/h7-13H2,1-4H3 |
| InChIKey | NNZUCRWALAUDNO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The IUPAC name of tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (CID 70872876) is tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
What is the SMILES notation for tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The canonical SMILES for tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate is CC#CCN1CC(F)(F)OC2(CCN(C(=O)OC(C)(C)C)CC2)C1.
What is the InChIKey of tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The InChIKey is NNZUCRWALAUDNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26F2N2O3/c1-5-6-9-20-12-16(24-17(18,19)13-20)7-10-21(11-8-16)14(22)23-15(2,3)4/h7-13H2,1-4H3.
What are the key properties of tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate has a molecular weight of 344.40 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-but-2-ynyl-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate is sourced from PubChem (CID 70872876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).