C34H58O10 — CID 70872887
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(3,7,11,15-tetramethylhexadec-2-enoxy)oxan-2-yl]methyl acetate (PubChem CID 70872887) has the molecular formula C34H58O10 and a molecular weight of 626.83 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(3,7,11,15-tetramethylhexadec-2-enoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(3,7,11,15-tetramethylhexadec-2-enoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70872887 |
| Molecular Formula | C34H58O10 |
| Molecular Weight | 626.83 g/mol |
| Exact Mass | 626.40 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(3,7,11,15-tetramethylhexadec-2-enoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H58O10/c1-22(2)13-10-14-23(3)15-11-16-24(4)17-12-18-25(5)19-20-39-34-33(43-29(9)38)32(42-28(8)37)31(41-27(7)36)30(44-34)21-40-26(6)35/h19,22-24,30-34H,10-18,20-21H2,1-9H3/t23?,24?,30-,31-,32+,33-,34?/m1/s1 |
| InChIKey | JSNKWCIXAOMNCP-PHEBMJRMSA-N |
| XLogP | 6.47 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.83 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|