C30H50O10 — CID 70872895
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(4,8,12-trimethyltridec-3-enoxy)oxan-2-yl]methyl acetate (PubChem CID 70872895) has the molecular formula C30H50O10 and a molecular weight of 570.72 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(4,8,12-trimethyltridec-3-enoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(4,8,12-trimethyltridec-3-enoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70872895 |
| Molecular Formula | C30H50O10 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(4,8,12-trimethyltridec-3-enoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OCCC=C(C)CCCC(C)CCCC(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H50O10/c1-19(2)12-9-13-20(3)14-10-15-21(4)16-11-17-35-30-29(39-25(8)34)28(38-24(7)33)27(37-23(6)32)26(40-30)18-36-22(5)31/h16,19-20,26-30H,9-15,17-18H2,1-8H3/t20?,26-,27-,28+,29-,30?/m1/s1 |
| InChIKey | ATPVRTOJHCFCDU-MSZNXKGJSA-N |
| XLogP | 5.06 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|