C29H48O10 — CID 70872968
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(3,7,11-trimethyldodec-2-enoxy)oxan-2-yl]methyl acetate (PubChem CID 70872968) has the molecular formula C29H48O10 and a molecular weight of 556.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(3,7,11-trimethyldodec-2-enoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(3,7,11-trimethyldodec-2-enoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70872968 |
| Molecular Formula | C29H48O10 |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(3,7,11-trimethyldodec-2-enoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OCC=C(C)CCCC(C)CCCC(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H48O10/c1-18(2)11-9-12-19(3)13-10-14-20(4)15-16-34-29-28(38-24(8)33)27(37-23(7)32)26(36-22(6)31)25(39-29)17-35-21(5)30/h15,18-19,25-29H,9-14,16-17H2,1-8H3/t19?,25-,26-,27+,28-,29?/m1/s1 |
| InChIKey | FJCMGSXZQBSAIF-VSVAPEFQSA-N |
| XLogP | 4.67 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|