C36H62O10 — CID 70872980
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(5,9,13,17-tetramethyloctadec-4-enoxy)oxan-2-yl]methyl acetate (PubChem CID 70872980) has the molecular formula C36H62O10 and a molecular weight of 654.88 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(5,9,13,17-tetramethyloctadec-4-enoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(5,9,13,17-tetramethyloctadec-4-enoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70872980 |
| Molecular Formula | C36H62O10 |
| Molecular Weight | 654.88 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(5,9,13,17-tetramethyloctadec-4-enoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OCCCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C36H62O10/c1-24(2)15-12-17-26(4)19-14-21-27(5)20-13-18-25(3)16-10-11-22-41-36-35(45-31(9)40)34(44-30(8)39)33(43-29(7)38)32(46-36)23-42-28(6)37/h16,24,26-27,32-36H,10-15,17-23H2,1-9H3/t26?,27?,32-,33-,34+,35-,36?/m1/s1 |
| InChIKey | VJDKKPFSCODFCE-OKMREDJMSA-N |
| XLogP | 7.25 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.88 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|