C20H26N2O4 — CID 70873168
(2R,3S,4R,5S,6R)-5,6-bis(benzylamino)-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 70873168) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-5,6-bis(benzylamino)-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R,5S,6R)-5,6-bis(benzylamino)-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 70873168 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (2R,3S,4R,5S,6R)-5,6-bis(benzylamino)-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](NCc2ccccc2)[C@@H](NCc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H26N2O4/c23-13-16-18(24)19(25)17(21-11-14-7-3-1-4-8-14)20(26-16)22-12-15-9-5-2-6-10-15/h1-10,16-25H,11-13H2/t16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | WBZWWIAIVJIFMI-USYVTKNRSA-N |
| XLogP | 0.37 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |