C27H47F3O3Sn — CID 70873452
2,3,7,9-tetramethyl-8-[(E)-2-tributylstannylethenyl]-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 70873452) has the molecular formula C27H47F3O3Sn and a molecular weight of 595.38 g/mol. Its IUPAC name is 2,3,7,9-tetramethyl-8-[(E)-2-tributylstannylethenyl]-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | 2,3,7,9-tetramethyl-8-[(E)-2-tributylstannylethenyl]-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 70873452 |
| Molecular Formula | C27H47F3O3Sn |
| Molecular Weight | 595.38 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 2,3,7,9-tetramethyl-8-[(E)-2-tributylstannylethenyl]-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CCCC[Sn](/C=C/C1(O)C(C)=CC2(CC1(C)C(F)(F)F)OC(C)C(C)O2)(CCCC)CCCC |
| InChI | InChI=1S/C15H20F3O3.3C4H9.Sn/c1-6-14(19)9(2)7-13(20-10(3)11(4)21-13)8-12(14,5)15(16,17)18;3*1-3-4-2;/h1,6-7,10-11,19H,8H2,2-5H3;3*1,3-4H2,2H3; |
| InChIKey | BFYYOEJRSHLITG-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.38 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|