C23H25ClN2O2 — CID 70873628
methyl 2-[7-[benzyl(methyl)amino]-3-chloro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate (PubChem CID 70873628) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is methyl 2-[7-[benzyl(methyl)amino]-3-chloro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate.
| Compound Name | methyl 2-[7-[benzyl(methyl)amino]-3-chloro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate |
|---|---|
| PubChem CID | 70873628 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | methyl 2-[7-[benzyl(methyl)amino]-3-chloro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate |
| SMILES | COC(=O)Cc1c2n(c3cc(Cl)ccc13)CC(N(C)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C23H25ClN2O2/c1-25(14-16-6-4-3-5-7-16)18-9-11-21-20(13-23(27)28-2)19-10-8-17(24)12-22(19)26(21)15-18/h3-8,10,12,18H,9,11,13-15H2,1-2H3 |
| InChIKey | GLSYMMUIHMHBLL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|