About 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol
2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol (PubChem CID 70874209) has the molecular formula C16H15FN4O
and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol |
| PubChem CID | 70874209 |
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol |
| SMILES | Cn1cncc1C(O)CC1c2c(F)cccc2-c2cncn21 |
| InChI | InChI=1S/C16H15FN4O/c1-20-8-18-7-14(20)15(22)5-12-16-10(3-2-4-11(16)17)13-6-19-9-21(12)13/h2-4,6-9,12,15,22H,5H2,1H3 |
| InChIKey | SHRFEOBHMXWKSI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol?
The IUPAC name of 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol (CID 70874209) is 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol.
What is the SMILES notation for 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol?
The canonical SMILES for 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol is Cn1cncc1C(O)CC1c2c(F)cccc2-c2cncn21.
What is the InChIKey of 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol?
The InChIKey is SHRFEOBHMXWKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN4O/c1-20-8-18-7-14(20)15(22)5-12-16-10(3-2-4-11(16)17)13-6-19-9-21(12)13/h2-4,6-9,12,15,22H,5H2,1H3.
What are the key properties of 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol?
2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol has a molecular weight of 298.32 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(3-methylimidazol-4-yl)ethanol is sourced from PubChem (CID 70874209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).