C22H35FN2OS — CID 7087442
(2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol (PubChem CID 7087442) has the molecular formula C22H35FN2OS and a molecular weight of 394.60 g/mol. Its IUPAC name is (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol.
| Compound Name | (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
|---|---|
| PubChem CID | 7087442 |
| Molecular Formula | C22H35FN2OS |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
| SMILES | C[C@H]1C[C@@H](OC[C@H](S)CN2CCN(c3ccc(F)cc3)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C22H35FN2OS/c1-17-12-20(14-22(2,3)13-17)26-16-21(27)15-24-8-10-25(11-9-24)19-6-4-18(23)5-7-19/h4-7,17,20-21,27H,8-16H2,1-3H3/t17-,20+,21+/m0/s1 |
| InChIKey | BTIQAQKFOTYDAV-IOMROCGXSA-N |
| XLogP | 4.48 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|