About 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid
2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 70874588) has the molecular formula C21H27F3O3
and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| PubChem CID | 70874588 |
| Molecular Formula | C21H27F3O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | CC1(C)CC=C(c2cccc(C(F)(F)F)c2C(OC(C)(C)C)C(=O)O)CC1 |
| InChI | InChI=1S/C21H27F3O3/c1-19(2,3)27-17(18(25)26)16-14(7-6-8-15(16)21(22,23)24)13-9-11-20(4,5)12-10-13/h6-9,17H,10-12H2,1-5H3,(H,25,26) |
| InChIKey | NOJGDGFCXXSTSZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid?
The IUPAC name of 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (CID 70874588) is 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
What is the SMILES notation for 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid?
The canonical SMILES for 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid is CC1(C)CC=C(c2cccc(C(F)(F)F)c2C(OC(C)(C)C)C(=O)O)CC1.
What is the InChIKey of 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid?
The InChIKey is NOJGDGFCXXSTSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27F3O3/c1-19(2,3)27-17(18(25)26)16-14(7-6-8-15(16)21(22,23)24)13-9-11-20(4,5)12-10-13/h6-9,17H,10-12H2,1-5H3,(H,25,26).
What are the key properties of 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid?
2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid has a molecular weight of 384.44 g/mol, XLogP of 6.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid is sourced from PubChem (CID 70874588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).