C33H34F3N5O4 — CID 70874685
2-nitro-7-[[4-[4-[[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 70874685) has the molecular formula C33H34F3N5O4 and a molecular weight of 621.66 g/mol. Its IUPAC name is 2-nitro-7-[[4-[4-[[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | 2-nitro-7-[[4-[4-[[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 70874685 |
| Molecular Formula | C33H34F3N5O4 |
| Molecular Weight | 621.66 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | 2-nitro-7-[[4-[4-[[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC(COc1ccc(N3CCN(Cc4ccc(CCc5ccc(C(F)(F)F)cc5)cc4)CC3)cc1)CC2 |
| InChI | InChI=1S/C33H34F3N5O4/c34-33(35,36)27-9-7-25(8-10-27)2-1-24-3-5-26(6-4-24)21-38-17-19-39(20-18-38)28-11-13-29(14-12-28)44-23-30-15-16-40-22-31(41(42)43)37-32(40)45-30/h3-14,22,30H,1-2,15-21,23H2 |
| InChIKey | YPVSOGQMDDCHGP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|