C25H24ClF3N4O6 — CID 70874848
7-[[3-chloro-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 70874848) has the molecular formula C25H24ClF3N4O6 and a molecular weight of 568.94 g/mol. Its IUPAC name is 7-[[3-chloro-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | 7-[[3-chloro-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 70874848 |
| Molecular Formula | C25H24ClF3N4O6 |
| Molecular Weight | 568.94 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 7-[[3-chloro-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC(COc1ccc(N3CCC(Oc4ccc(OC(F)(F)F)cc4)CC3)c(Cl)c1)CC2 |
| InChI | InChI=1S/C25H24ClF3N4O6/c26-21-13-19(36-15-20-9-12-32-14-23(33(34)35)30-24(32)38-20)5-6-22(21)31-10-7-17(8-11-31)37-16-1-3-18(4-2-16)39-25(27,28)29/h1-6,13-14,17,20H,7-12,15H2 |
| InChIKey | VZVBZEVDEJPIRP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 101.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.94 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|