C13H15FN4O — CID 70875015
(1S,4R)-3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 70875015) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is (1S,4R)-3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,4R)-3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 70875015 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1S,4R)-3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1ncc(F)c(NC2C(C(N)=O)[C@@H]3C=C[C@H]2C3)n1 |
| InChI | InChI=1S/C13H15FN4O/c1-6-16-5-9(14)13(17-6)18-11-8-3-2-7(4-8)10(11)12(15)19/h2-3,5,7-8,10-11H,4H2,1H3,(H2,15,19)(H,16,17,18)/t7-,8+,10?,11?/m1/s1 |
| InChIKey | RBHWUPODAKNOGH-NOFHBMEESA-N |
| XLogP | 1.01 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|