C21H17N5O — CID 70875223
2-N-[4-[(3-pyridin-4-yl-2-pyridinyl)oxy]phenyl]pyridine-2,4-diamine (PubChem CID 70875223) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-N-[4-[(3-pyridin-4-yl-2-pyridinyl)oxy]phenyl]pyridine-2,4-diamine.
| Compound Name | 2-N-[4-[(3-pyridin-4-yl-2-pyridinyl)oxy]phenyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 70875223 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-N-[4-[(3-pyridin-4-yl-2-pyridinyl)oxy]phenyl]pyridine-2,4-diamine |
| SMILES | Nc1ccnc(Nc2ccc(Oc3ncccc3-c3ccncc3)cc2)c1 |
| InChI | InChI=1S/C21H17N5O/c22-16-9-13-24-20(14-16)26-17-3-5-18(6-4-17)27-21-19(2-1-10-25-21)15-7-11-23-12-8-15/h1-14H,(H3,22,24,26) |
| InChIKey | XUJDLZXPXNHQBV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |