About 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine
2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine (PubChem CID 70875326) has the molecular formula C12H18FNO
and a molecular weight of 211.28 g/mol. Its IUPAC name is 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine.
Molecular Properties
| Compound Name | 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine |
| PubChem CID | 70875326 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine |
| SMILES | CC1COC(CC2C=CC(F)=CC2)CN1 |
| InChI | InChI=1S/C12H18FNO/c1-9-8-15-12(7-14-9)6-10-2-4-11(13)5-3-10/h2,4-5,9-10,12,14H,3,6-8H2,1H3 |
| InChIKey | JIDBBNBWEANSAB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine?
The IUPAC name of 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine (CID 70875326) is 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine.
What is the SMILES notation for 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine?
The canonical SMILES for 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine is CC1COC(CC2C=CC(F)=CC2)CN1.
What is the InChIKey of 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine?
The InChIKey is JIDBBNBWEANSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FNO/c1-9-8-15-12(7-14-9)6-10-2-4-11(13)5-3-10/h2,4-5,9-10,12,14H,3,6-8H2,1H3.
What are the key properties of 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine?
2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine has a molecular weight of 211.28 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-5-methylmorpholine is sourced from PubChem (CID 70875326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).