C18H23F3N4 — CID 70875648
trans-(2R,5S)-5-(3-methyl-4,6-dihydro-2H-pyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine (PubChem CID 70875648) has the molecular formula C18H23F3N4 and a molecular weight of 352.40 g/mol. Its IUPAC name is trans-(2R,5S)-5-(3-methyl-4,6-dihydro-2H-pyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine.
| Compound Name | trans-(2R,5S)-5-(3-methyl-4,6-dihydro-2H-pyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 70875648 |
| Molecular Formula | C18H23F3N4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | trans-(2R,5S)-5-(3-methyl-4,6-dihydro-2H-pyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine |
| SMILES | Cc1[nH]nc2c1CN([C@H]1CC[C@H](C3CC(F)=C(F)C=C3F)C(N)C1)C2 |
| InChI | InChI=1S/C18H23F3N4/c1-9-13-7-25(8-18(13)24-23-9)10-2-3-11(17(22)4-10)12-5-15(20)16(21)6-14(12)19/h6,10-12,17H,2-5,7-8,22H2,1H3,(H,23,24)/t10-,11+,12?,17?/m0/s1 |
| InChIKey | MBXJYXMDKBBSIO-KLVDIUJHSA-N |
| XLogP | 3.55 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |