C29H28NO4+ — CID 70875920
9-benzyl-2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium (PubChem CID 70875920) has the molecular formula C29H28NO4+ and a molecular weight of 454.55 g/mol. Its IUPAC name is 9-benzyl-2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium.
| Compound Name | 9-benzyl-2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium |
|---|---|
| PubChem CID | 70875920 |
| Molecular Formula | C29H28NO4+ |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 9-benzyl-2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium |
| SMILES | COc1cc2ccc3c4cc(Cc5ccccc5)c(OC)c(OC)c4c[n+](C)c3c2cc1OC |
| InChI | InChI=1S/C29H28NO4/c1-30-17-24-23(14-20(28(33-4)29(24)34-5)13-18-9-7-6-8-10-18)21-12-11-19-15-25(31-2)26(32-3)16-22(19)27(21)30/h6-12,14-17H,13H2,1-5H3/q+1 |
| InChIKey | QRTXVVSPAZBFFY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|