About 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione
2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione (PubChem CID 70876201) has the molecular formula C13H9FN2O4
and a molecular weight of 276.22 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione |
| PubChem CID | 70876201 |
| Molecular Formula | C13H9FN2O4 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H9FN2O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h1-2,5,9H,3-4H2,(H,15,17,18) |
| InChIKey | MPQLCQKBYRSPNA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione?
The IUPAC name of 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione (CID 70876201) is 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione.
What is the SMILES notation for 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione?
The canonical SMILES for 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione is O=C1CCC(N2C(=O)c3ccc(F)cc3C2=O)C(=O)N1.
What is the InChIKey of 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione?
The InChIKey is MPQLCQKBYRSPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FN2O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h1-2,5,9H,3-4H2,(H,15,17,18).
What are the key properties of 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione?
2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione has a molecular weight of 276.22 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione is sourced from PubChem (CID 70876201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).