C16H17I — CID 70876606
7-iodo-3,9,9-trimethyl-3,4-dihydrofluorene (PubChem CID 70876606) has the molecular formula C16H17I and a molecular weight of 336.22 g/mol. Its IUPAC name is 7-iodo-3,9,9-trimethyl-3,4-dihydrofluorene.
| Compound Name | 7-iodo-3,9,9-trimethyl-3,4-dihydrofluorene |
|---|---|
| PubChem CID | 70876606 |
| Molecular Formula | C16H17I |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 7-iodo-3,9,9-trimethyl-3,4-dihydrofluorene |
| SMILES | CC1C=CC2=C(C1)c1ccc(I)cc1C2(C)C |
| InChI | InChI=1S/C16H17I/c1-10-4-7-14-13(8-10)12-6-5-11(17)9-15(12)16(14,2)3/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | RADZGQSEFIBTJF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|