About 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol
2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol (PubChem CID 70876839) has the molecular formula C17H34O3S
and a molecular weight of 318.52 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol.
Molecular Properties
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol |
| PubChem CID | 70876839 |
| Molecular Formula | C17H34O3S |
| Molecular Weight | 318.52 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol |
| SMILES | CC(C)(C)C1CC(CSCC(O)O)CC(C(C)(C)C)C1O |
| InChI | InChI=1S/C17H34O3S/c1-16(2,3)12-7-11(9-21-10-14(18)19)8-13(15(12)20)17(4,5)6/h11-15,18-20H,7-10H2,1-6H3 |
| InChIKey | BSHUNVVSCKNTPU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol?
The IUPAC name of 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol (CID 70876839) is 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol.
What is the SMILES notation for 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol?
The canonical SMILES for 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol is CC(C)(C)C1CC(CSCC(O)O)CC(C(C)(C)C)C1O.
What is the InChIKey of 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol?
The InChIKey is BSHUNVVSCKNTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3S/c1-16(2,3)12-7-11(9-21-10-14(18)19)8-13(15(12)20)17(4,5)6/h11-15,18-20H,7-10H2,1-6H3.
What are the key properties of 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol?
2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol has a molecular weight of 318.52 g/mol, XLogP of 3.13, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-ditert-butyl-4-hydroxycyclohexyl)methylsulfanyl]ethane-1,1-diol is sourced from PubChem (CID 70876839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).