C37H33IN2O9 — CID 70876885
2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoic acid (PubChem CID 70876885) has the molecular formula C37H33IN2O9 and a molecular weight of 776.58 g/mol. Its IUPAC name is 2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoic acid.
| Compound Name | 2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 70876885 |
| Molecular Formula | C37H33IN2O9 |
| Molecular Weight | 776.58 g/mol |
| Exact Mass | 776.12 |
| IUPAC Name | 2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoic acid |
| SMILES | O=C(CCCc1ccc(I)cc1)NCCCCC(NC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)C(=O)O |
| InChI | InChI=1S/C37H33IN2O9/c38-23-10-7-21(8-11-23)4-3-6-33(43)39-17-2-1-5-30(35(45)46)40-34(44)22-9-14-27-26(18-22)36(47)49-37(27)28-15-12-24(41)19-31(28)48-32-20-25(42)13-16-29(32)37/h7-16,18-20,30,41-42H,1-6,17H2,(H,39,43)(H,40,44)(H,45,46) |
| InChIKey | OFSJPZMJFIILMS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 171.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|