C46H42N8O4S4 — CID 70877282
1-[[4,6-bis(propylsulfanyl)-1,3,5-triazin-2-yl]amino]-4-[4-[[4,6-bis(propylsulfanyl)-1,3,5-triazin-2-yl]amino]-9,10-dioxoanthracen-1-yl]anthracene-9,10-dione (PubChem CID 70877282) has the molecular formula C46H42N8O4S4 and a molecular weight of 899.16 g/mol. Its IUPAC name is 1-[[4,6-bis(propylsulfanyl)-1,3,5-triazin-2-yl]amino]-4-[4-[[4,6-bis(propylsulfanyl)-1,3,5-triazin-2-yl]amino]-9,10-dioxoanthracen-1-yl]anthracene-9,10-dione.
| Compound Name | 1-[[4,6-bis(propylsulfanyl)-1,3,5-triazin-2-yl]amino]-4-[4-[[4,6-bis(propylsulfanyl)-1,3,5-triazin-2-yl]amino]-9,10-dioxoanthracen-1-yl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 70877282 |
| Molecular Formula | C46H42N8O4S4 |
| Molecular Weight | 899.16 g/mol |
| Exact Mass | 898.22 |
| IUPAC Name | 1-[[4,6-bis(propylsulfanyl)-1,3,5-triazin-2-yl]amino]-4-[4-[[4,6-bis(propylsulfanyl)-1,3,5-triazin-2-yl]amino]-9,10-dioxoanthracen-1-yl]anthracene-9,10-dione |
| SMILES | CCCSc1nc(Nc2ccc(-c3ccc(Nc4nc(SCCC)nc(SCCC)n4)c4c3C(=O)c3ccccc3C4=O)c3c2C(=O)c2ccccc2C3=O)nc(SCCC)n1 |
| InChI | InChI=1S/C46H42N8O4S4/c1-5-21-59-43-49-41(50-44(53-43)60-22-6-2)47-31-19-17-25(33-35(31)39(57)29-15-11-9-13-27(29)37(33)55)26-18-20-32(36-34(26)38(56)28-14-10-12-16-30(28)40(36)58)48-42-51-45(61-23-7-3)54-46(52-42)62-24-8-4/h9-20H,5-8,21-24H2,1-4H3,(H,47,49,50,53)(H,48,51,52,54) |
| InChIKey | VANYDDFWDZERDP-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 169.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.16 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|