C25H29F2N3O5 — CID 70877523
(7R)-11-butoxy-N-[(2,4-difluorophenyl)methyl]-N,7-dimethyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 70877523) has the molecular formula C25H29F2N3O5 and a molecular weight of 489.52 g/mol. Its IUPAC name is (7R)-11-butoxy-N-[(2,4-difluorophenyl)methyl]-N,7-dimethyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (7R)-11-butoxy-N-[(2,4-difluorophenyl)methyl]-N,7-dimethyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 70877523 |
| Molecular Formula | C25H29F2N3O5 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (7R)-11-butoxy-N-[(2,4-difluorophenyl)methyl]-N,7-dimethyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)N(C)Cc3ccc(F)cc3F)c1=O)CC1OCC[C@@H](C)N1C2=O |
| InChI | InChI=1S/C25H29F2N3O5/c1-4-5-9-35-23-21-25(33)30-15(2)8-10-34-20(30)14-29(21)13-18(22(23)31)24(32)28(3)12-16-6-7-17(26)11-19(16)27/h6-7,11,13,15,20H,4-5,8-10,12,14H2,1-3H3/t15-,20?/m1/s1 |
| InChIKey | JPJDBBJOXSJTQN-IWPPFLRJSA-N |
| XLogP | 3.17 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|