About N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide
N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide (PubChem CID 70877797) has the molecular formula C12H24N4
and a molecular weight of 224.35 g/mol. Its IUPAC name is N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide |
| PubChem CID | 70877797 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide |
| SMILES | CC/C(=C\N/C(C)=N/C)CN1CCC(N)C1 |
| InChI | InChI=1S/C12H24N4/c1-4-11(7-15-10(2)14-3)8-16-6-5-12(13)9-16/h7,12H,4-6,8-9,13H2,1-3H3,(H,14,15)/b11-7+ |
| InChIKey | UVJVJUMKANDQPD-YRNVUSSQSA-N |
| XLogP | 0.95 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide?
The IUPAC name of N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide (CID 70877797) is N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide.
What is the SMILES notation for N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide?
The canonical SMILES for N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide is CC/C(=C\N/C(C)=N/C)CN1CCC(N)C1.
What is the InChIKey of N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide?
The InChIKey is UVJVJUMKANDQPD-YRNVUSSQSA-N. The full InChI is InChI=1S/C12H24N4/c1-4-11(7-15-10(2)14-3)8-16-6-5-12(13)9-16/h7,12H,4-6,8-9,13H2,1-3H3,(H,14,15)/b11-7+.
What are the key properties of N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide?
N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide has a molecular weight of 224.35 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2-[(3-aminopyrrolidin-1-yl)methyl]but-1-enyl]-N'-methylethanimidamide is sourced from PubChem (CID 70877797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).