6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid

C9H7BrO3 — CID 70877959

IUPAC6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid
SMILESO=C(O)C1Cc2ccc(Br)cc2O1
InChIInChI=1S/C9H7BrO3/c10-6-2-1-5-3-8(9(11)12)13-7(5)4-6/h1-2,4,8H,3H2,(H,11,12)
InChIKeyOCVAAFRREAQYGY-UHFFFAOYSA-N
MW243.06 g/mol
LogP1.84
Rot. Bonds1

About 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid

6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid (PubChem CID 70877959) has the molecular formula C9H7BrO3 and a molecular weight of 243.06 g/mol. Its IUPAC name is 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid.

Molecular Properties

Compound Name6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid
PubChem CID70877959
Molecular FormulaC9H7BrO3
Molecular Weight243.06 g/mol
Exact Mass241.96
IUPAC Name6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid
SMILESO=C(O)C1Cc2ccc(Br)cc2O1
InChIInChI=1S/C9H7BrO3/c10-6-2-1-5-3-8(9(11)12)13-7(5)4-6/h1-2,4,8H,3H2,(H,11,12)
InChIKeyOCVAAFRREAQYGY-UHFFFAOYSA-N
XLogP1.84
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.06
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The IUPAC name of 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid (CID 70877959) is 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid.
What is the SMILES notation for 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The canonical SMILES for 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid is O=C(O)C1Cc2ccc(Br)cc2O1.
What is the InChIKey of 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The InChIKey is OCVAAFRREAQYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO3/c10-6-2-1-5-3-8(9(11)12)13-7(5)4-6/h1-2,4,8H,3H2,(H,11,12).
What are the key properties of 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid?
6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid has a molecular weight of 243.06 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid is sourced from PubChem (CID 70877959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).