C24H33N3O — CID 70878068
6-(3,3-dimethylbutan-2-ylamino)-4,9-di(propan-2-yl)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 70878068) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 6-(3,3-dimethylbutan-2-ylamino)-4,9-di(propan-2-yl)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-(3,3-dimethylbutan-2-ylamino)-4,9-di(propan-2-yl)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 70878068 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 6-(3,3-dimethylbutan-2-ylamino)-4,9-di(propan-2-yl)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CC(C)c1ccc2c(NC(C)C(C)(C)C)nc3c(C(C)C)c[nH]c(=O)c3c2c1 |
| InChI | InChI=1S/C24H33N3O/c1-13(2)16-9-10-17-18(11-16)20-21(19(14(3)4)12-25-23(20)28)27-22(17)26-15(5)24(6,7)8/h9-15H,1-8H3,(H,25,28)(H,26,27) |
| InChIKey | JVWSGDBTKNXDOW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|