C30H60O2Si2 — CID 70878081
[6-[(1R,3aR,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylhept-5-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 70878081) has the molecular formula C30H60O2Si2 and a molecular weight of 508.98 g/mol. Its IUPAC name is [6-[(1R,3aR,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylhept-5-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [6-[(1R,3aR,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylhept-5-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 70878081 |
| Molecular Formula | C30H60O2Si2 |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | [6-[(1R,3aR,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylhept-5-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(=CCCC(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2C(O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C30H60O2Si2/c1-23(17-15-21-29(8,9)32-34(13,14)28(5,6)7)24-19-20-25-26(18-16-22-30(24,25)10)31-33(11,12)27(2,3)4/h17,24-26H,15-16,18-22H2,1-14H3/t24-,25+,26?,30-/m1/s1 |
| InChIKey | XTSQSEOLKLWRIJ-DSQWYCOESA-N |
| XLogP | 10.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|