C14H15N3S — CID 70879073
2-[(3aR,4S,9bS)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinolin-4-yl]-1,3-thiazole (PubChem CID 70879073) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-[(3aR,4S,9bS)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinolin-4-yl]-1,3-thiazole.
| Compound Name | 2-[(3aR,4S,9bS)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinolin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 70879073 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[(3aR,4S,9bS)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinolin-4-yl]-1,3-thiazole |
| SMILES | c1ccc2c(c1)N[C@H](c1nccs1)[C@@H]1CCN[C@H]21 |
| InChI | InChI=1S/C14H15N3S/c1-2-4-11-9(3-1)12-10(5-6-15-12)13(17-11)14-16-7-8-18-14/h1-4,7-8,10,12-13,15,17H,5-6H2/t10-,12-,13+/m1/s1 |
| InChIKey | CZQAVTJMOQIRNM-RTXFEEFZSA-N |
| XLogP | 2.96 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |