About N,N-diethyl-4,4-difluoropiperidine-3-carboxamide
N,N-diethyl-4,4-difluoropiperidine-3-carboxamide (PubChem CID 70879127) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is N,N-diethyl-4,4-difluoropiperidine-3-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-4,4-difluoropiperidine-3-carboxamide |
| PubChem CID | 70879127 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N,N-diethyl-4,4-difluoropiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CNCCC1(F)F |
| InChI | InChI=1S/C10H18F2N2O/c1-3-14(4-2)9(15)8-7-13-6-5-10(8,11)12/h8,13H,3-7H2,1-2H3 |
| InChIKey | GLPJQKDKSGIUEA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethyl-4,4-difluoropiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4,4-difluoropiperidine-3-carboxamide?
The IUPAC name of N,N-diethyl-4,4-difluoropiperidine-3-carboxamide (CID 70879127) is N,N-diethyl-4,4-difluoropiperidine-3-carboxamide.
What is the SMILES notation for N,N-diethyl-4,4-difluoropiperidine-3-carboxamide?
The canonical SMILES for N,N-diethyl-4,4-difluoropiperidine-3-carboxamide is CCN(CC)C(=O)C1CNCCC1(F)F.
What is the InChIKey of N,N-diethyl-4,4-difluoropiperidine-3-carboxamide?
The InChIKey is GLPJQKDKSGIUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-3-14(4-2)9(15)8-7-13-6-5-10(8,11)12/h8,13H,3-7H2,1-2H3.
What are the key properties of N,N-diethyl-4,4-difluoropiperidine-3-carboxamide?
N,N-diethyl-4,4-difluoropiperidine-3-carboxamide has a molecular weight of 220.26 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4,4-difluoropiperidine-3-carboxamide is sourced from PubChem (CID 70879127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).