C37H49N5O3 — CID 70879301
(2S,5R)-3-amino-5-[[(E)-4-(1-aminocyclobutyl)but-2-enoyl]-methylamino]-N-(2-aminopropan-2-yl)-2-benzyl-N,3-dimethyl-6-naphthalen-2-yl-4-oxohexanamide (PubChem CID 70879301) has the molecular formula C37H49N5O3 and a molecular weight of 611.83 g/mol. Its IUPAC name is (2S,5R)-3-amino-5-[[(E)-4-(1-aminocyclobutyl)but-2-enoyl]-methylamino]-N-(2-aminopropan-2-yl)-2-benzyl-N,3-dimethyl-6-naphthalen-2-yl-4-oxohexanamide.
| Compound Name | (2S,5R)-3-amino-5-[[(E)-4-(1-aminocyclobutyl)but-2-enoyl]-methylamino]-N-(2-aminopropan-2-yl)-2-benzyl-N,3-dimethyl-6-naphthalen-2-yl-4-oxohexanamide |
|---|---|
| PubChem CID | 70879301 |
| Molecular Formula | C37H49N5O3 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.38 |
| IUPAC Name | (2S,5R)-3-amino-5-[[(E)-4-(1-aminocyclobutyl)but-2-enoyl]-methylamino]-N-(2-aminopropan-2-yl)-2-benzyl-N,3-dimethyl-6-naphthalen-2-yl-4-oxohexanamide |
| SMILES | CN(C(=O)/C=C/CC1(N)CCC1)[C@H](Cc1ccc2ccccc2c1)C(=O)C(C)(N)[C@H](Cc1ccccc1)C(=O)N(C)C(C)(C)N |
| InChI | InChI=1S/C37H49N5O3/c1-35(2,38)42(5)34(45)30(24-26-13-7-6-8-14-26)36(3,39)33(44)31(25-27-18-19-28-15-9-10-16-29(28)23-27)41(4)32(43)17-11-20-37(40)21-12-22-37/h6-11,13-19,23,30-31H,12,20-22,24-25,38-40H2,1-5H3/b17-11+/t30-,31-,36?/m1/s1 |
| InChIKey | MVRXYEMTHVVCPG-QWXAEECJSA-N |
| XLogP | 4.34 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|