C15H24O4 — CID 70879621
(4'aS)-1'-(2-hydroxyethyl)-4'a-methylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-2'-ol (PubChem CID 70879621) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (4'aS)-1'-(2-hydroxyethyl)-4'a-methylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-2'-ol.
| Compound Name | (4'aS)-1'-(2-hydroxyethyl)-4'a-methylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-2'-ol |
|---|---|
| PubChem CID | 70879621 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (4'aS)-1'-(2-hydroxyethyl)-4'a-methylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-2'-ol |
| SMILES | C[C@]12CCC(O)C(CCO)=C1CCCC21OCCO1 |
| InChI | InChI=1S/C15H24O4/c1-14-7-4-13(17)11(5-8-16)12(14)3-2-6-15(14)18-9-10-19-15/h13,16-17H,2-10H2,1H3/t13?,14-/m0/s1 |
| InChIKey | YXWQPYVWPBNBDA-KZUDCZAMSA-N |
| XLogP | 1.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|