C16H20N2 — CID 70879624
(9R)-8,8,9-trimethyl-7,9,10,11-tetrahydrobenzo[b][1,4]benzodiazepine (PubChem CID 70879624) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (9R)-8,8,9-trimethyl-7,9,10,11-tetrahydrobenzo[b][1,4]benzodiazepine.
| Compound Name | (9R)-8,8,9-trimethyl-7,9,10,11-tetrahydrobenzo[b][1,4]benzodiazepine |
|---|---|
| PubChem CID | 70879624 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (9R)-8,8,9-trimethyl-7,9,10,11-tetrahydrobenzo[b][1,4]benzodiazepine |
| SMILES | C[C@@H]1CC2=C(C=Nc3ccccc3N2)CC1(C)C |
| InChI | InChI=1S/C16H20N2/c1-11-8-15-12(9-16(11,2)3)10-17-13-6-4-5-7-14(13)18-15/h4-7,10-11,18H,8-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | UCOPJNVLIKABLB-LLVKDONJSA-N |
| XLogP | 4.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |