C24H36BN3O5 — CID 70879691
tert-butyl (2S,4S)-4-hydroxy-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 70879691) has the molecular formula C24H36BN3O5 and a molecular weight of 457.38 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-hydroxy-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-hydroxy-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70879691 |
| Molecular Formula | C24H36BN3O5 |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | tert-butyl (2S,4S)-4-hydroxy-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O)C[C@H]1C1=NCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)N1 |
| InChI | InChI=1S/C24H36BN3O5/c1-22(2,3)31-21(30)28-14-17(29)12-19(28)20-26-13-18(27-20)15-8-10-16(11-9-15)25-32-23(4,5)24(6,7)33-25/h8-11,17-19,29H,12-14H2,1-7H3,(H,26,27)/t17-,18?,19-/m0/s1 |
| InChIKey | VWHMJJIHBJTCJA-JVUMBYKBSA-N |
| XLogP | 2.40 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|