About 1-methoxy-2,6,9-trimethylcyclododecane
1-methoxy-2,6,9-trimethylcyclododecane (PubChem CID 70879863) has the molecular formula C16H32O
and a molecular weight of 240.43 g/mol. Its IUPAC name is 1-methoxy-2,6,9-trimethylcyclododecane.
Molecular Properties
| Compound Name | 1-methoxy-2,6,9-trimethylcyclododecane |
| PubChem CID | 70879863 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 1-methoxy-2,6,9-trimethylcyclododecane |
| SMILES | COC1CCCC(C)CCC(C)CCCC1C |
| InChI | InChI=1S/C16H32O/c1-13-7-5-9-15(3)16(17-4)10-6-8-14(2)12-11-13/h13-16H,5-12H2,1-4H3 |
| InChIKey | YKJPKWSPWFPIJF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxy-2,6,9-trimethylcyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,6,9-trimethylcyclododecane?
The IUPAC name of 1-methoxy-2,6,9-trimethylcyclododecane (CID 70879863) is 1-methoxy-2,6,9-trimethylcyclododecane.
What is the SMILES notation for 1-methoxy-2,6,9-trimethylcyclododecane?
The canonical SMILES for 1-methoxy-2,6,9-trimethylcyclododecane is COC1CCCC(C)CCC(C)CCCC1C.
What is the InChIKey of 1-methoxy-2,6,9-trimethylcyclododecane?
The InChIKey is YKJPKWSPWFPIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O/c1-13-7-5-9-15(3)16(17-4)10-6-8-14(2)12-11-13/h13-16H,5-12H2,1-4H3.
What are the key properties of 1-methoxy-2,6,9-trimethylcyclododecane?
1-methoxy-2,6,9-trimethylcyclododecane has a molecular weight of 240.43 g/mol, XLogP of 5.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,6,9-trimethylcyclododecane is sourced from PubChem (CID 70879863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).