About (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate
(4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate (PubChem CID 70879961) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate.
Molecular Properties
| Compound Name | (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate |
| PubChem CID | 70879961 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate |
| SMILES | CCCOC1CC(OC)C(OC(C)=O)=CO1 |
| InChI | InChI=1S/C11H18O5/c1-4-5-14-11-6-9(13-3)10(7-15-11)16-8(2)12/h7,9,11H,4-6H2,1-3H3 |
| InChIKey | MVRIDVQGNOPGBY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate?
The IUPAC name of (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate (CID 70879961) is (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate.
What is the SMILES notation for (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate?
The canonical SMILES for (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate is CCCOC1CC(OC)C(OC(C)=O)=CO1.
What is the InChIKey of (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate?
The InChIKey is MVRIDVQGNOPGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O5/c1-4-5-14-11-6-9(13-3)10(7-15-11)16-8(2)12/h7,9,11H,4-6H2,1-3H3.
What are the key properties of (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate?
(4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate has a molecular weight of 230.26 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-2-propoxy-3,4-dihydro-2H-pyran-5-yl) acetate is sourced from PubChem (CID 70879961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).