About 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol
4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol (PubChem CID 70880045) has the molecular formula C38H29NO4
and a molecular weight of 563.65 g/mol. Its IUPAC name is 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol.
Molecular Properties
| Compound Name | 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol |
| PubChem CID | 70880045 |
| Molecular Formula | C38H29NO4 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol |
| SMILES | Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3C(c3ccc(O)cc3)(c3ccc(O)cc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C38H29NO4/c40-31-18-10-26(11-19-31)37(27-12-20-32(41)21-13-27)35-8-4-5-9-36(35)38(28-14-22-33(42)23-15-28,29-16-24-34(43)25-17-29)39(37)30-6-2-1-3-7-30/h1-25,40-43H |
| InChIKey | CFNFXZBJEOSTGA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol?
The IUPAC name of 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol (CID 70880045) is 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol.
What is the SMILES notation for 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol?
The canonical SMILES for 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol is Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3C(c3ccc(O)cc3)(c3ccc(O)cc3)N2c2ccccc2)cc1.
What is the InChIKey of 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol?
The InChIKey is CFNFXZBJEOSTGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H29NO4/c40-31-18-10-26(11-19-31)37(27-12-20-32(41)21-13-27)35-8-4-5-9-36(35)38(28-14-22-33(42)23-15-28,29-16-24-34(43)25-17-29)39(37)30-6-2-1-3-7-30/h1-25,40-43H.
What are the key properties of 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol?
4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol has a molecular weight of 563.65 g/mol, XLogP of 7.61, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,3,3-tris(4-hydroxyphenyl)-2-phenylisoindol-1-yl]phenol is sourced from PubChem (CID 70880045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).