C18H32O2 — CID 70880079
(3aR,4S,7aS)-1-[(2S)-1-(2,2-dimethylpropoxy)propan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 70880079) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (3aR,4S,7aS)-1-[(2S)-1-(2,2-dimethylpropoxy)propan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (3aR,4S,7aS)-1-[(2S)-1-(2,2-dimethylpropoxy)propan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 70880079 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (3aR,4S,7aS)-1-[(2S)-1-(2,2-dimethylpropoxy)propan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@H](COCC(C)(C)C)C1=CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C18H32O2/c1-13(11-20-12-17(2,3)4)14-8-9-15-16(19)7-6-10-18(14,15)5/h8,13,15-16,19H,6-7,9-12H2,1-5H3/t13-,15+,16+,18-/m1/s1 |
| InChIKey | FIMVUSPPVXZPBR-GRZALLJUSA-N |
| XLogP | 4.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|