C26H48O5 — CID 70880393
(2S,3S,5S)-2,3,4,5-tetramethyl-2-[[(2S,3R,5R)-3,4,5-trimethyl-2-[[(2R,3R,5R)-2,3,4,5-tetramethyloxolan-2-yl]oxymethyl]oxolan-2-yl]oxymethyl]oxane (PubChem CID 70880393) has the molecular formula C26H48O5 and a molecular weight of 440.67 g/mol. Its IUPAC name is (2S,3S,5S)-2,3,4,5-tetramethyl-2-[[(2S,3R,5R)-3,4,5-trimethyl-2-[[(2R,3R,5R)-2,3,4,5-tetramethyloxolan-2-yl]oxymethyl]oxolan-2-yl]oxymethyl]oxane.
| Compound Name | (2S,3S,5S)-2,3,4,5-tetramethyl-2-[[(2S,3R,5R)-3,4,5-trimethyl-2-[[(2R,3R,5R)-2,3,4,5-tetramethyloxolan-2-yl]oxymethyl]oxolan-2-yl]oxymethyl]oxane |
|---|---|
| PubChem CID | 70880393 |
| Molecular Formula | C26H48O5 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | (2S,3S,5S)-2,3,4,5-tetramethyl-2-[[(2S,3R,5R)-3,4,5-trimethyl-2-[[(2R,3R,5R)-2,3,4,5-tetramethyloxolan-2-yl]oxymethyl]oxolan-2-yl]oxymethyl]oxane |
| SMILES | CC1[C@@H](C)[C@](C)(OC[C@@]2(OC[C@@]3(C)OC[C@@H](C)C(C)[C@@H]3C)O[C@H](C)C(C)[C@H]2C)O[C@@H]1C |
| InChI | InChI=1S/C26H48O5/c1-15-12-27-24(10,19(5)16(15)2)13-29-26(21(7)18(4)23(9)31-26)14-28-25(11)20(6)17(3)22(8)30-25/h15-23H,12-14H2,1-11H3/t15-,16?,17?,18?,19+,20-,21-,22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | ITVIGZKEZXQNEZ-BPZKGOGKSA-N |
| XLogP | 5.51 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |