C15H28OSi — CID 70880476
3a,4,5,6,7,7a-hexahydro-3H-inden-4-yloxy(triethyl)silane (PubChem CID 70880476) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydro-3H-inden-4-yloxy(triethyl)silane.
| Compound Name | 3a,4,5,6,7,7a-hexahydro-3H-inden-4-yloxy(triethyl)silane |
|---|---|
| PubChem CID | 70880476 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydro-3H-inden-4-yloxy(triethyl)silane |
| SMILES | CC[Si](CC)(CC)OC1CCCC2C=CCC21 |
| InChI | InChI=1S/C15H28OSi/c1-4-17(5-2,6-3)16-15-12-8-10-13-9-7-11-14(13)15/h7,9,13-15H,4-6,8,10-12H2,1-3H3 |
| InChIKey | BBSAXAFEHHOBAW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|