C26H23BrFNO6 — CID 70880933
(1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-1,8b-dihydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide (PubChem CID 70880933) has the molecular formula C26H23BrFNO6 and a molecular weight of 544.37 g/mol. Its IUPAC name is (1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-1,8b-dihydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide.
| Compound Name | (1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-1,8b-dihydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 70880933 |
| Molecular Formula | C26H23BrFNO6 |
| Molecular Weight | 544.37 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | (1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-1,8b-dihydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Br)cc3)[C@H](c3cccc(F)c3)[C@@H](C(N)=O)[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C26H23BrFNO6/c1-33-17-11-18(34-2)22-19(12-17)35-26(14-6-8-15(27)9-7-14)21(13-4-3-5-16(28)10-13)20(24(29)31)23(30)25(22,26)32/h3-12,20-21,23,30,32H,1-2H3,(H2,29,31)/t20-,21-,23-,25+,26+/m1/s1 |
| InChIKey | NQTLNWZYQVTYSQ-VRFYTPIESA-N |
| XLogP | 3.34 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |