C14H18O6 — CID 70881455
(3S,4aR,7aS)-7a-acetyl-3,4a,6,7-tetramethyl-5-oxo-2H-cyclopenta[b][1,4]dioxine-3-carboxylic acid (PubChem CID 70881455) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is (3S,4aR,7aS)-7a-acetyl-3,4a,6,7-tetramethyl-5-oxo-2H-cyclopenta[b][1,4]dioxine-3-carboxylic acid.
| Compound Name | (3S,4aR,7aS)-7a-acetyl-3,4a,6,7-tetramethyl-5-oxo-2H-cyclopenta[b][1,4]dioxine-3-carboxylic acid |
|---|---|
| PubChem CID | 70881455 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (3S,4aR,7aS)-7a-acetyl-3,4a,6,7-tetramethyl-5-oxo-2H-cyclopenta[b][1,4]dioxine-3-carboxylic acid |
| SMILES | CC(=O)[C@@]12OC[C@@](C)(C(=O)O)O[C@@]1(C)C(=O)C(C)=C2C |
| InChI | InChI=1S/C14H18O6/c1-7-8(2)14(9(3)15)13(5,10(7)16)20-12(4,6-19-14)11(17)18/h6H2,1-5H3,(H,17,18)/t12-,13-,14+/m0/s1 |
| InChIKey | IRWKDRYWQIEKIZ-MELADBBJSA-N |
| XLogP | 0.88 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |