C44H42N2 — CID 70882025
2,7-dimethyl-9-N,9-N,10-N,10-N-tetrakis(4-methylphenyl)-1,4-dihydroanthracene-9,10-diamine (PubChem CID 70882025) has the molecular formula C44H42N2 and a molecular weight of 598.83 g/mol. Its IUPAC name is 2,7-dimethyl-9-N,9-N,10-N,10-N-tetrakis(4-methylphenyl)-1,4-dihydroanthracene-9,10-diamine.
| Compound Name | 2,7-dimethyl-9-N,9-N,10-N,10-N-tetrakis(4-methylphenyl)-1,4-dihydroanthracene-9,10-diamine |
|---|---|
| PubChem CID | 70882025 |
| Molecular Formula | C44H42N2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 2,7-dimethyl-9-N,9-N,10-N,10-N-tetrakis(4-methylphenyl)-1,4-dihydroanthracene-9,10-diamine |
| SMILES | CC1=CCc2c(c(N(c3ccc(C)cc3)c3ccc(C)cc3)c3cc(C)ccc3c2N(c2ccc(C)cc2)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C44H42N2/c1-29-7-17-35(18-8-29)45(36-19-9-30(2)10-20-36)43-39-25-15-33(5)27-41(39)44(42-28-34(6)16-26-40(42)43)46(37-21-11-31(3)12-22-37)38-23-13-32(4)14-24-38/h7-25,27H,26,28H2,1-6H3 |
| InChIKey | UHEXYKBYXBBTEL-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|