C20H24N2O4 — CID 70882599
1,4-bis[4-(2-hydroxyethylamino)phenyl]butane-1,4-dione (PubChem CID 70882599) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1,4-bis[4-(2-hydroxyethylamino)phenyl]butane-1,4-dione.
| Compound Name | 1,4-bis[4-(2-hydroxyethylamino)phenyl]butane-1,4-dione |
|---|---|
| PubChem CID | 70882599 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1,4-bis[4-(2-hydroxyethylamino)phenyl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccc(NCCO)cc1)c1ccc(NCCO)cc1 |
| InChI | InChI=1S/C20H24N2O4/c23-13-11-21-17-5-1-15(2-6-17)19(25)9-10-20(26)16-3-7-18(8-4-16)22-12-14-24/h1-8,21-24H,9-14H2 |
| InChIKey | JJLNNHJCKLKQEQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |