C18H25F3O6 — CID 70882733
2,2,2-trifluoroethyl 2-[(2,6-dimethyl-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl)oxy]-2-methylcyclohexane-1-carboxylate (PubChem CID 70882733) has the molecular formula C18H25F3O6 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2,6-dimethyl-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl)oxy]-2-methylcyclohexane-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2,6-dimethyl-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl)oxy]-2-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70882733 |
| Molecular Formula | C18H25F3O6 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2,6-dimethyl-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl)oxy]-2-methylcyclohexane-1-carboxylate |
| SMILES | CC1OC2C(C)C(=O)OC2C1OC1(C)CCCCC1C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C18H25F3O6/c1-9-12-14(26-15(9)22)13(10(2)25-12)27-17(3)7-5-4-6-11(17)16(23)24-8-18(19,20)21/h9-14H,4-8H2,1-3H3 |
| InChIKey | NGKMETQDPHXUOT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |