About 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine
1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine (PubChem CID 70882750) has the molecular formula C13H24FNO
and a molecular weight of 229.34 g/mol. Its IUPAC name is 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine.
Molecular Properties
| Compound Name | 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine |
| PubChem CID | 70882750 |
| Molecular Formula | C13H24FNO |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine |
| SMILES | CC1CCN(C[C@H]2OCC[C@@H](F)[C@H]2C)CC1 |
| InChI | InChI=1S/C13H24FNO/c1-10-3-6-15(7-4-10)9-13-11(2)12(14)5-8-16-13/h10-13H,3-9H2,1-2H3/t11-,12-,13-/m1/s1 |
| InChIKey | KEPJRIVHFZUBQB-JHJVBQTASA-N |
| XLogP | 2.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine?
The IUPAC name of 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine (CID 70882750) is 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine.
What is the SMILES notation for 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine?
The canonical SMILES for 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine is CC1CCN(C[C@H]2OCC[C@@H](F)[C@H]2C)CC1.
What is the InChIKey of 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine?
The InChIKey is KEPJRIVHFZUBQB-JHJVBQTASA-N. The full InChI is InChI=1S/C13H24FNO/c1-10-3-6-15(7-4-10)9-13-11(2)12(14)5-8-16-13/h10-13H,3-9H2,1-2H3/t11-,12-,13-/m1/s1.
What are the key properties of 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine?
1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine has a molecular weight of 229.34 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2S,3S,4R)-4-fluoro-3-methyloxan-2-yl]methyl]-4-methylpiperidine is sourced from PubChem (CID 70882750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).