About 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine
4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine (PubChem CID 70882810) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine.
Molecular Properties
| Compound Name | 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine |
| PubChem CID | 70882810 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine |
| SMILES | CC1CCN(C[C@H]2OCCC[C@H]2C)CC1 |
| InChI | InChI=1S/C13H25NO/c1-11-5-7-14(8-6-11)10-13-12(2)4-3-9-15-13/h11-13H,3-10H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | BWZPDZHFEANNHF-CHWSQXEVSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine?
The IUPAC name of 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine (CID 70882810) is 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine.
What is the SMILES notation for 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine?
The canonical SMILES for 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine is CC1CCN(C[C@H]2OCCC[C@H]2C)CC1.
What is the InChIKey of 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine?
The InChIKey is BWZPDZHFEANNHF-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H25NO/c1-11-5-7-14(8-6-11)10-13-12(2)4-3-9-15-13/h11-13H,3-10H2,1-2H3/t12-,13-/m1/s1.
What are the key properties of 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine?
4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine has a molecular weight of 211.35 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-[[(2S,3R)-3-methyloxan-2-yl]methyl]piperidine is sourced from PubChem (CID 70882810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).