C17H20O4 — CID 70883370
4-[2-[(3aR,5R,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]ethynyl]benzene-1,2-diol (PubChem CID 70883370) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-[2-[(3aR,5R,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]ethynyl]benzene-1,2-diol.
| Compound Name | 4-[2-[(3aR,5R,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]ethynyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 70883370 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-[2-[(3aR,5R,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]ethynyl]benzene-1,2-diol |
| SMILES | CC1(C)O[C@H]2CC[C@@H](C#Cc3ccc(O)c(O)c3)C[C@H]2O1 |
| InChI | InChI=1S/C17H20O4/c1-17(2)20-15-8-6-12(10-16(15)21-17)4-3-11-5-7-13(18)14(19)9-11/h5,7,9,12,15-16,18-19H,6,8,10H2,1-2H3/t12-,15+,16-/m1/s1 |
| InChIKey | KIDNRAKBTSFAJO-UHOFOFEASA-N |
| XLogP | 2.77 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|