C30H26N2O2 — CID 7088344
(6R,9S)-9-(4-methoxyphenyl)-6-naphthalen-2-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 7088344) has the molecular formula C30H26N2O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is (6R,9S)-9-(4-methoxyphenyl)-6-naphthalen-2-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9S)-9-(4-methoxyphenyl)-6-naphthalen-2-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 7088344 |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (6R,9S)-9-(4-methoxyphenyl)-6-naphthalen-2-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)Nc2ccccc2N[C@@H]3c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C30H26N2O2/c1-34-24-14-12-20(13-15-24)23-17-27-29(28(33)18-23)30(32-26-9-5-4-8-25(26)31-27)22-11-10-19-6-2-3-7-21(19)16-22/h2-16,23,30-32H,17-18H2,1H3/t23-,30+/m0/s1 |
| InChIKey | GTAYUCKXHAMCRM-YUDQIZAISA-N |
| XLogP | 6.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |